C25H23ClN2O5 — CID 46425036
methyl 2-[3-[[3-[(2-chlorobenzoyl)amino]-3-phenylpropanoyl]amino]phenoxy]acetate (PubChem CID 46425036) has the molecular formula C25H23ClN2O5 and a molecular weight of 466.92 g/mol. Its IUPAC name is methyl 2-[3-[[3-[(2-chlorobenzoyl)amino]-3-phenylpropanoyl]amino]phenoxy]acetate.
| Compound Name | methyl 2-[3-[[3-[(2-chlorobenzoyl)amino]-3-phenylpropanoyl]amino]phenoxy]acetate |
|---|---|
| PubChem CID | 46425036 |
| Molecular Formula | C25H23ClN2O5 |
| Molecular Weight | 466.92 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | methyl 2-[3-[[3-[(2-chlorobenzoyl)amino]-3-phenylpropanoyl]amino]phenoxy]acetate |
| SMILES | COC(=O)COc1cccc(NC(=O)CC(NC(=O)c2ccccc2Cl)c2ccccc2)c1 |
| InChI | InChI=1S/C25H23ClN2O5/c1-32-24(30)16-33-19-11-7-10-18(14-19)27-23(29)15-22(17-8-3-2-4-9-17)28-25(31)20-12-5-6-13-21(20)26/h2-14,22H,15-16H2,1H3,(H,27,29)(H,28,31) |
| InChIKey | AKQZKPUWCHRYFY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.92 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |