C23H26ClN3O5 — CID 55418410
[2-(butylcarbamoylamino)-2-oxoethyl] 3-[(2-chlorobenzoyl)amino]-3-phenylpropanoate (PubChem CID 55418410) has the molecular formula C23H26ClN3O5 and a molecular weight of 459.93 g/mol. Its IUPAC name is [2-(butylcarbamoylamino)-2-oxoethyl] 3-[(2-chlorobenzoyl)amino]-3-phenylpropanoate.
| Compound Name | [2-(butylcarbamoylamino)-2-oxoethyl] 3-[(2-chlorobenzoyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 55418410 |
| Molecular Formula | C23H26ClN3O5 |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | [2-(butylcarbamoylamino)-2-oxoethyl] 3-[(2-chlorobenzoyl)amino]-3-phenylpropanoate |
| SMILES | CCCCNC(=O)NC(=O)COC(=O)CC(NC(=O)c1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C23H26ClN3O5/c1-2-3-13-25-23(31)27-20(28)15-32-21(29)14-19(16-9-5-4-6-10-16)26-22(30)17-11-7-8-12-18(17)24/h4-12,19H,2-3,13-15H2,1H3,(H,26,30)(H2,25,27,28,31) |
| InChIKey | YFHNVGLYAYEOMV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|