C22H25N3O5 — CID 8809612
[2-[[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl] (3S)-3-benzamido-3-phenylpropanoate (PubChem CID 8809612) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is [2-[[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl] (3S)-3-benzamido-3-phenylpropanoate.
| Compound Name | [2-[[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl] (3S)-3-benzamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 8809612 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | [2-[[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl] (3S)-3-benzamido-3-phenylpropanoate |
| SMILES | CCNC(=O)CNC(=O)COC(=O)C[C@H](NC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H25N3O5/c1-2-23-19(26)14-24-20(27)15-30-21(28)13-18(16-9-5-3-6-10-16)25-22(29)17-11-7-4-8-12-17/h3-12,18H,2,13-15H2,1H3,(H,23,26)(H,24,27)(H,25,29)/t18-/m0/s1 |
| InChIKey | FNIVPECUTGCOPG-SFHVURJKSA-N |
| XLogP | 1.34 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |