C19H18BrN3O6 — CID 46819835
[2-(2-bromo-4-nitroanilino)-2-oxoethyl] 3-benzamidobutanoate (PubChem CID 46819835) has the molecular formula C19H18BrN3O6 and a molecular weight of 464.27 g/mol. Its IUPAC name is [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 3-benzamidobutanoate.
| Compound Name | [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 3-benzamidobutanoate |
|---|---|
| PubChem CID | 46819835 |
| Molecular Formula | C19H18BrN3O6 |
| Molecular Weight | 464.27 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 3-benzamidobutanoate |
| SMILES | CC(CC(=O)OCC(=O)Nc1ccc([N+](=O)[O-])cc1Br)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H18BrN3O6/c1-12(21-19(26)13-5-3-2-4-6-13)9-18(25)29-11-17(24)22-16-8-7-14(23(27)28)10-15(16)20/h2-8,10,12H,9,11H2,1H3,(H,21,26)(H,22,24) |
| InChIKey | BNWSEKIHWMAVIB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.27 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|