C20H20ClN3O6 — CID 55315691
[2-(2-chloro-4-nitroanilino)-2-oxoethyl] 2-benzamido-3-methylbutanoate (PubChem CID 55315691) has the molecular formula C20H20ClN3O6 and a molecular weight of 433.85 g/mol. Its IUPAC name is [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 2-benzamido-3-methylbutanoate.
| Compound Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 2-benzamido-3-methylbutanoate |
|---|---|
| PubChem CID | 55315691 |
| Molecular Formula | C20H20ClN3O6 |
| Molecular Weight | 433.85 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 2-benzamido-3-methylbutanoate |
| SMILES | CC(C)C(NC(=O)c1ccccc1)C(=O)OCC(=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C20H20ClN3O6/c1-12(2)18(23-19(26)13-6-4-3-5-7-13)20(27)30-11-17(25)22-16-9-8-14(24(28)29)10-15(16)21/h3-10,12,18H,11H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | SFZHJHUFSYVIRA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.85 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|