C24H28ClN3O6 — CID 55927719
[2-oxo-2-(1-phenylbutylamino)ethyl] (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate (PubChem CID 55927719) has the molecular formula C24H28ClN3O6 and a molecular weight of 489.96 g/mol. Its IUPAC name is [2-oxo-2-(1-phenylbutylamino)ethyl] (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate.
| Compound Name | [2-oxo-2-(1-phenylbutylamino)ethyl] (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 55927719 |
| Molecular Formula | C24H28ClN3O6 |
| Molecular Weight | 489.96 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | [2-oxo-2-(1-phenylbutylamino)ethyl] (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate |
| SMILES | CCCC(NC(=O)COC(=O)[C@@H](NC(=O)c1ccc([N+](=O)[O-])cc1Cl)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C24H28ClN3O6/c1-4-8-20(16-9-6-5-7-10-16)26-21(29)14-34-24(31)22(15(2)3)27-23(30)18-12-11-17(28(32)33)13-19(18)25/h5-7,9-13,15,20,22H,4,8,14H2,1-3H3,(H,26,29)(H,27,30)/t20?,22-/m0/s1 |
| InChIKey | FPRWYQYTZHARFT-IAXKEJLGSA-N |
| XLogP | 4.20 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.96 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|