C20H19ClFN3O6 — CID 55927157
[2-(3-fluoroanilino)-2-oxoethyl] (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate (PubChem CID 55927157) has the molecular formula C20H19ClFN3O6 and a molecular weight of 451.84 g/mol. Its IUPAC name is [2-(3-fluoroanilino)-2-oxoethyl] (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate.
| Compound Name | [2-(3-fluoroanilino)-2-oxoethyl] (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 55927157 |
| Molecular Formula | C20H19ClFN3O6 |
| Molecular Weight | 451.84 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | [2-(3-fluoroanilino)-2-oxoethyl] (2S)-2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(=O)c1ccc([N+](=O)[O-])cc1Cl)C(=O)OCC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C20H19ClFN3O6/c1-11(2)18(24-19(27)15-7-6-14(25(29)30)9-16(15)21)20(28)31-10-17(26)23-13-5-3-4-12(22)8-13/h3-9,11,18H,10H2,1-2H3,(H,23,26)(H,24,27)/t18-/m0/s1 |
| InChIKey | DSAYMTCXODHHBE-SFHVURJKSA-N |
| XLogP | 3.32 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.84 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|