C20H21ClN4O7 — CID 55324431
[2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate (PubChem CID 55324431) has the molecular formula C20H21ClN4O7 and a molecular weight of 464.86 g/mol. Its IUPAC name is [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate.
| Compound Name | [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 55324431 |
| Molecular Formula | C20H21ClN4O7 |
| Molecular Weight | 464.86 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoate |
| SMILES | CC(C)C(NC(=O)c1ccc([N+](=O)[O-])cc1Cl)C(=O)OCC(=O)NC(=O)c1cccn1C |
| InChI | InChI=1S/C20H21ClN4O7/c1-11(2)17(23-18(27)13-7-6-12(25(30)31)9-14(13)21)20(29)32-10-16(26)22-19(28)15-5-4-8-24(15)3/h4-9,11,17H,10H2,1-3H3,(H,23,27)(H,22,26,28) |
| InChIKey | FWPHXHHECIKIPI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 149.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.86 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|