C21H16ClN3O6 — CID 31393905
[2-(1-methylpyrrol-2-yl)-2-oxoethyl] 2-[(2-chloro-4-nitrobenzoyl)amino]benzoate (PubChem CID 31393905) has the molecular formula C21H16ClN3O6 and a molecular weight of 441.83 g/mol. Its IUPAC name is [2-(1-methylpyrrol-2-yl)-2-oxoethyl] 2-[(2-chloro-4-nitrobenzoyl)amino]benzoate.
| Compound Name | [2-(1-methylpyrrol-2-yl)-2-oxoethyl] 2-[(2-chloro-4-nitrobenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 31393905 |
| Molecular Formula | C21H16ClN3O6 |
| Molecular Weight | 441.83 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | [2-(1-methylpyrrol-2-yl)-2-oxoethyl] 2-[(2-chloro-4-nitrobenzoyl)amino]benzoate |
| SMILES | Cn1cccc1C(=O)COC(=O)c1ccccc1NC(=O)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C21H16ClN3O6/c1-24-10-4-7-18(24)19(26)12-31-21(28)15-5-2-3-6-17(15)23-20(27)14-9-8-13(25(29)30)11-16(14)22/h2-11H,12H2,1H3,(H,23,27) |
| InChIKey | AKUMENNTAZRNFF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 120.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.83 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|