C22H17ClN2O5 — CID 18291785
(4-methylphenyl)methyl 2-[(2-chloro-4-nitrobenzoyl)amino]benzoate (PubChem CID 18291785) has the molecular formula C22H17ClN2O5 and a molecular weight of 424.84 g/mol. Its IUPAC name is (4-methylphenyl)methyl 2-[(2-chloro-4-nitrobenzoyl)amino]benzoate.
| Compound Name | (4-methylphenyl)methyl 2-[(2-chloro-4-nitrobenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 18291785 |
| Molecular Formula | C22H17ClN2O5 |
| Molecular Weight | 424.84 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | (4-methylphenyl)methyl 2-[(2-chloro-4-nitrobenzoyl)amino]benzoate |
| SMILES | Cc1ccc(COC(=O)c2ccccc2NC(=O)c2ccc([N+](=O)[O-])cc2Cl)cc1 |
| InChI | InChI=1S/C22H17ClN2O5/c1-14-6-8-15(9-7-14)13-30-22(27)18-4-2-3-5-20(18)24-21(26)17-11-10-16(25(28)29)12-19(17)23/h2-12H,13H2,1H3,(H,24,26) |
| InChIKey | XVPWWOHDZQJWPK-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.84 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|