About (4-tert-butylphenyl)methyl 2-chloro-4-nitrobenzoate
(4-tert-butylphenyl)methyl 2-chloro-4-nitrobenzoate (PubChem CID 926002) has the molecular formula C18H18ClNO4
and a molecular weight of 347.80 g/mol. Its IUPAC name is (4-tert-butylphenyl)methyl 2-chloro-4-nitrobenzoate.
Molecular Properties
| Compound Name | (4-tert-butylphenyl)methyl 2-chloro-4-nitrobenzoate |
| PubChem CID | 926002 |
| Molecular Formula | C18H18ClNO4 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | (4-tert-butylphenyl)methyl 2-chloro-4-nitrobenzoate |
| SMILES | CC(C)(C)c1ccc(COC(=O)c2ccc([N+](=O)[O-])cc2Cl)cc1 |
| InChI | InChI=1S/C18H18ClNO4/c1-18(2,3)13-6-4-12(5-7-13)11-24-17(21)15-9-8-14(20(22)23)10-16(15)19/h4-10H,11H2,1-3H3 |
| InChIKey | UQIAQCPCBOPREY-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-tert-butylphenyl)methyl 2-chloro-4-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-tert-butylphenyl)methyl 2-chloro-4-nitrobenzoate?
The IUPAC name of (4-tert-butylphenyl)methyl 2-chloro-4-nitrobenzoate (CID 926002) is (4-tert-butylphenyl)methyl 2-chloro-4-nitrobenzoate.
What is the SMILES notation for (4-tert-butylphenyl)methyl 2-chloro-4-nitrobenzoate?
The canonical SMILES for (4-tert-butylphenyl)methyl 2-chloro-4-nitrobenzoate is CC(C)(C)c1ccc(COC(=O)c2ccc([N+](=O)[O-])cc2Cl)cc1.
What is the InChIKey of (4-tert-butylphenyl)methyl 2-chloro-4-nitrobenzoate?
The InChIKey is UQIAQCPCBOPREY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18ClNO4/c1-18(2,3)13-6-4-12(5-7-13)11-24-17(21)15-9-8-14(20(22)23)10-16(15)19/h4-10H,11H2,1-3H3.
What are the key properties of (4-tert-butylphenyl)methyl 2-chloro-4-nitrobenzoate?
(4-tert-butylphenyl)methyl 2-chloro-4-nitrobenzoate has a molecular weight of 347.80 g/mol, XLogP of 4.90, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-tert-butylphenyl)methyl 2-chloro-4-nitrobenzoate is sourced from PubChem (CID 926002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).