C22H13ClF2N2O6 — CID 42973277
[2-(3,4-difluorophenyl)-2-oxoethyl] 2-[(2-chloro-4-nitrobenzoyl)amino]benzoate (PubChem CID 42973277) has the molecular formula C22H13ClF2N2O6 and a molecular weight of 474.80 g/mol. Its IUPAC name is [2-(3,4-difluorophenyl)-2-oxoethyl] 2-[(2-chloro-4-nitrobenzoyl)amino]benzoate.
| Compound Name | [2-(3,4-difluorophenyl)-2-oxoethyl] 2-[(2-chloro-4-nitrobenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 42973277 |
| Molecular Formula | C22H13ClF2N2O6 |
| Molecular Weight | 474.80 g/mol |
| Exact Mass | 474.04 |
| IUPAC Name | [2-(3,4-difluorophenyl)-2-oxoethyl] 2-[(2-chloro-4-nitrobenzoyl)amino]benzoate |
| SMILES | O=C(COC(=O)c1ccccc1NC(=O)c1ccc([N+](=O)[O-])cc1Cl)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C22H13ClF2N2O6/c23-16-10-13(27(31)32)6-7-14(16)21(29)26-19-4-2-1-3-15(19)22(30)33-11-20(28)12-5-8-17(24)18(25)9-12/h1-10H,11H2,(H,26,29) |
| InChIKey | FHFSSXPETJWXIS-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.80 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|