C24H17ClN4O6 — CID 43033394
(8-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(2-chloro-4-nitrobenzoyl)amino]benzoate (PubChem CID 43033394) has the molecular formula C24H17ClN4O6 and a molecular weight of 492.88 g/mol. Its IUPAC name is (8-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(2-chloro-4-nitrobenzoyl)amino]benzoate.
| Compound Name | (8-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(2-chloro-4-nitrobenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 43033394 |
| Molecular Formula | C24H17ClN4O6 |
| Molecular Weight | 492.88 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | (8-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(2-chloro-4-nitrobenzoyl)amino]benzoate |
| SMILES | Cc1ccn2c(=O)cc(COC(=O)c3ccccc3NC(=O)c3ccc([N+](=O)[O-])cc3Cl)nc2c1 |
| InChI | InChI=1S/C24H17ClN4O6/c1-14-8-9-28-21(10-14)26-15(11-22(28)30)13-35-24(32)18-4-2-3-5-20(18)27-23(31)17-7-6-16(29(33)34)12-19(17)25/h2-12H,13H2,1H3,(H,27,31) |
| InChIKey | NJYQKGDPMMSSHZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 132.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.88 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|