C22H17ClN6O4 — CID 134030666
2-chloro-4-nitro-N-[2-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethylcarbamoyl]phenyl]benzamide (PubChem CID 134030666) has the molecular formula C22H17ClN6O4 and a molecular weight of 464.87 g/mol. Its IUPAC name is 2-chloro-4-nitro-N-[2-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethylcarbamoyl]phenyl]benzamide.
| Compound Name | 2-chloro-4-nitro-N-[2-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethylcarbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 134030666 |
| Molecular Formula | C22H17ClN6O4 |
| Molecular Weight | 464.87 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 2-chloro-4-nitro-N-[2-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethylcarbamoyl]phenyl]benzamide |
| SMILES | CC(NC(=O)c1ccccc1NC(=O)c1ccc([N+](=O)[O-])cc1Cl)c1nnc2ccccn12 |
| InChI | InChI=1S/C22H17ClN6O4/c1-13(20-27-26-19-8-4-5-11-28(19)20)24-22(31)16-6-2-3-7-18(16)25-21(30)15-10-9-14(29(32)33)12-17(15)23/h2-13H,1H3,(H,24,31)(H,25,30) |
| InChIKey | RGTBQAMSOBQTGV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 131.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.87 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|