C21H15ClN6O4 — CID 29239510
2-chloro-4-nitro-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethylcarbamoyl)phenyl]benzamide (PubChem CID 29239510) has the molecular formula C21H15ClN6O4 and a molecular weight of 450.84 g/mol. Its IUPAC name is 2-chloro-4-nitro-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethylcarbamoyl)phenyl]benzamide.
| Compound Name | 2-chloro-4-nitro-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 29239510 |
| Molecular Formula | C21H15ClN6O4 |
| Molecular Weight | 450.84 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 2-chloro-4-nitro-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethylcarbamoyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1C(=O)NCc1nnc2ccccn12)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C21H15ClN6O4/c22-16-11-13(28(31)32)8-9-14(16)21(30)24-17-6-2-1-5-15(17)20(29)23-12-19-26-25-18-7-3-4-10-27(18)19/h1-11H,12H2,(H,23,29)(H,24,30) |
| InChIKey | VDRWXPHLHPNCNV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 131.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.84 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|