C15H12F2N6O4 — CID 87010347
1-[2-(difluoromethoxy)-5-nitrophenyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)urea (PubChem CID 87010347) has the molecular formula C15H12F2N6O4 and a molecular weight of 378.30 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)-5-nitrophenyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)urea.
| Compound Name | 1-[2-(difluoromethoxy)-5-nitrophenyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 87010347 |
| Molecular Formula | C15H12F2N6O4 |
| Molecular Weight | 378.30 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 1-[2-(difluoromethoxy)-5-nitrophenyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)urea |
| SMILES | O=C(NCc1nnc2ccccn12)Nc1cc([N+](=O)[O-])ccc1OC(F)F |
| InChI | InChI=1S/C15H12F2N6O4/c16-14(17)27-11-5-4-9(23(25)26)7-10(11)19-15(24)18-8-13-21-20-12-3-1-2-6-22(12)13/h1-7,14H,8H2,(H2,18,19,24) |
| InChIKey | NERIFAGJYCAJGX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|