C16H17F2N3O6 — CID 87010348
1-[2-(difluoromethoxy)-5-nitrophenyl]-3-[3-(furan-2-ylmethoxy)propyl]urea (PubChem CID 87010348) has the molecular formula C16H17F2N3O6 and a molecular weight of 385.32 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)-5-nitrophenyl]-3-[3-(furan-2-ylmethoxy)propyl]urea.
| Compound Name | 1-[2-(difluoromethoxy)-5-nitrophenyl]-3-[3-(furan-2-ylmethoxy)propyl]urea |
|---|---|
| PubChem CID | 87010348 |
| Molecular Formula | C16H17F2N3O6 |
| Molecular Weight | 385.32 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 1-[2-(difluoromethoxy)-5-nitrophenyl]-3-[3-(furan-2-ylmethoxy)propyl]urea |
| SMILES | O=C(NCCCOCc1ccco1)Nc1cc([N+](=O)[O-])ccc1OC(F)F |
| InChI | InChI=1S/C16H17F2N3O6/c17-15(18)27-14-5-4-11(21(23)24)9-13(14)20-16(22)19-6-2-7-25-10-12-3-1-8-26-12/h1,3-5,8-9,15H,2,6-7,10H2,(H2,19,20,22) |
| InChIKey | ZSHHSTGQDHPNDL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 115.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|