C13H12F2N2O3 — CID 47129823
1-[2-(difluoromethoxy)phenyl]-3-(furan-2-ylmethyl)urea (PubChem CID 47129823) has the molecular formula C13H12F2N2O3 and a molecular weight of 282.25 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)phenyl]-3-(furan-2-ylmethyl)urea.
| Compound Name | 1-[2-(difluoromethoxy)phenyl]-3-(furan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 47129823 |
| Molecular Formula | C13H12F2N2O3 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 1-[2-(difluoromethoxy)phenyl]-3-(furan-2-ylmethyl)urea |
| SMILES | O=C(NCc1ccco1)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C13H12F2N2O3/c14-12(15)20-11-6-2-1-5-10(11)17-13(18)16-8-9-4-3-7-19-9/h1-7,12H,8H2,(H2,16,17,18) |
| InChIKey | PMGWMAUPBFGCSN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |