C16H13F5N2O3 — CID 4995803
1-[[2-(difluoromethoxy)phenyl]methyl]-3-[2-(trifluoromethoxy)phenyl]urea (PubChem CID 4995803) has the molecular formula C16H13F5N2O3 and a molecular weight of 376.28 g/mol. Its IUPAC name is 1-[[2-(difluoromethoxy)phenyl]methyl]-3-[2-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[[2-(difluoromethoxy)phenyl]methyl]-3-[2-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 4995803 |
| Molecular Formula | C16H13F5N2O3 |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 1-[[2-(difluoromethoxy)phenyl]methyl]-3-[2-(trifluoromethoxy)phenyl]urea |
| SMILES | O=C(NCc1ccccc1OC(F)F)Nc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C16H13F5N2O3/c17-14(18)25-12-7-3-1-5-10(12)9-22-15(24)23-11-6-2-4-8-13(11)26-16(19,20)21/h1-8,14H,9H2,(H2,22,23,24) |
| InChIKey | ANHBRMVIYDHZLE-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |