C16H12F6N2O3 — CID 3817679
1-[2-(trifluoromethoxy)phenyl]-3-[[2-(trifluoromethoxy)phenyl]methyl]urea (PubChem CID 3817679) has the molecular formula C16H12F6N2O3 and a molecular weight of 394.27 g/mol. Its IUPAC name is 1-[2-(trifluoromethoxy)phenyl]-3-[[2-(trifluoromethoxy)phenyl]methyl]urea.
| Compound Name | 1-[2-(trifluoromethoxy)phenyl]-3-[[2-(trifluoromethoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 3817679 |
| Molecular Formula | C16H12F6N2O3 |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 1-[2-(trifluoromethoxy)phenyl]-3-[[2-(trifluoromethoxy)phenyl]methyl]urea |
| SMILES | O=C(NCc1ccccc1OC(F)(F)F)Nc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C16H12F6N2O3/c17-15(18,19)26-12-7-3-1-5-10(12)9-23-14(25)24-11-6-2-4-8-13(11)27-16(20,21)22/h1-8H,9H2,(H2,23,24,25) |
| InChIKey | PSHATSFIIDCSDO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |