C13H18F3N2O5P — CID 3584248
1-diethoxyphosphoryl-3-[[2-(trifluoromethoxy)phenyl]methyl]urea (PubChem CID 3584248) has the molecular formula C13H18F3N2O5P and a molecular weight of 370.26 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-3-[[2-(trifluoromethoxy)phenyl]methyl]urea.
| Compound Name | 1-diethoxyphosphoryl-3-[[2-(trifluoromethoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 3584248 |
| Molecular Formula | C13H18F3N2O5P |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 1-diethoxyphosphoryl-3-[[2-(trifluoromethoxy)phenyl]methyl]urea |
| SMILES | CCOP(=O)(NC(=O)NCc1ccccc1OC(F)(F)F)OCC |
| InChI | InChI=1S/C13H18F3N2O5P/c1-3-21-24(20,22-4-2)18-12(19)17-9-10-7-5-6-8-11(10)23-13(14,15)16/h5-8H,3-4,9H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | QPCGRPNRLKAMAY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|