C21H24F3N3O3 — CID 112829565
N-butyl-4-[[[2-(trifluoromethoxy)phenyl]methylcarbamoylamino]methyl]benzamide (PubChem CID 112829565) has the molecular formula C21H24F3N3O3 and a molecular weight of 423.44 g/mol. Its IUPAC name is N-butyl-4-[[[2-(trifluoromethoxy)phenyl]methylcarbamoylamino]methyl]benzamide.
| Compound Name | N-butyl-4-[[[2-(trifluoromethoxy)phenyl]methylcarbamoylamino]methyl]benzamide |
|---|---|
| PubChem CID | 112829565 |
| Molecular Formula | C21H24F3N3O3 |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | N-butyl-4-[[[2-(trifluoromethoxy)phenyl]methylcarbamoylamino]methyl]benzamide |
| SMILES | CCCCNC(=O)c1ccc(CNC(=O)NCc2ccccc2OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H24F3N3O3/c1-2-3-12-25-19(28)16-10-8-15(9-11-16)13-26-20(29)27-14-17-6-4-5-7-18(17)30-21(22,23)24/h4-11H,2-3,12-14H2,1H3,(H,25,28)(H2,26,27,29) |
| InChIKey | CWADPPUCACSJLQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|