C28H30BrF3N2O2 — CID 69291655
3-bromo-N-[(4-pentylphenyl)methyl]-4-[[[2-(trifluoromethoxy)phenyl]methylamino]methyl]benzamide (PubChem CID 69291655) has the molecular formula C28H30BrF3N2O2 and a molecular weight of 563.46 g/mol. Its IUPAC name is 3-bromo-N-[(4-pentylphenyl)methyl]-4-[[[2-(trifluoromethoxy)phenyl]methylamino]methyl]benzamide.
| Compound Name | 3-bromo-N-[(4-pentylphenyl)methyl]-4-[[[2-(trifluoromethoxy)phenyl]methylamino]methyl]benzamide |
|---|---|
| PubChem CID | 69291655 |
| Molecular Formula | C28H30BrF3N2O2 |
| Molecular Weight | 563.46 g/mol |
| Exact Mass | 562.14 |
| IUPAC Name | 3-bromo-N-[(4-pentylphenyl)methyl]-4-[[[2-(trifluoromethoxy)phenyl]methylamino]methyl]benzamide |
| SMILES | CCCCCc1ccc(CNC(=O)c2ccc(CNCc3ccccc3OC(F)(F)F)c(Br)c2)cc1 |
| InChI | InChI=1S/C28H30BrF3N2O2/c1-2-3-4-7-20-10-12-21(13-11-20)17-34-27(35)22-14-15-23(25(29)16-22)18-33-19-24-8-5-6-9-26(24)36-28(30,31)32/h5-6,8-16,33H,2-4,7,17-19H2,1H3,(H,34,35) |
| InChIKey | JEXYHMIOGGBVCU-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.46 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|