C33H35BrN2O2 — CID 141074572
3-bromo-N-[(4-pentylphenyl)methyl]-4-[[(4-phenoxyphenyl)methylamino]methyl]benzamide (PubChem CID 141074572) has the molecular formula C33H35BrN2O2 and a molecular weight of 571.56 g/mol. Its IUPAC name is 3-bromo-N-[(4-pentylphenyl)methyl]-4-[[(4-phenoxyphenyl)methylamino]methyl]benzamide.
| Compound Name | 3-bromo-N-[(4-pentylphenyl)methyl]-4-[[(4-phenoxyphenyl)methylamino]methyl]benzamide |
|---|---|
| PubChem CID | 141074572 |
| Molecular Formula | C33H35BrN2O2 |
| Molecular Weight | 571.56 g/mol |
| Exact Mass | 570.19 |
| IUPAC Name | 3-bromo-N-[(4-pentylphenyl)methyl]-4-[[(4-phenoxyphenyl)methylamino]methyl]benzamide |
| SMILES | CCCCCc1ccc(CNC(=O)c2ccc(CNCc3ccc(Oc4ccccc4)cc3)c(Br)c2)cc1 |
| InChI | InChI=1S/C33H35BrN2O2/c1-2-3-5-8-25-11-13-27(14-12-25)23-36-33(37)28-17-18-29(32(34)21-28)24-35-22-26-15-19-31(20-16-26)38-30-9-6-4-7-10-30/h4,6-7,9-21,35H,2-3,5,8,22-24H2,1H3,(H,36,37) |
| InChIKey | BDQSAOMJIUFMKU-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.56 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|