C33H35ClN2O — CID 173155687
3-[4-[[(4-chlorophenyl)methylamino]methyl]phenyl]-N-[(4-pentylphenyl)methyl]benzamide (PubChem CID 173155687) has the molecular formula C33H35ClN2O and a molecular weight of 511.11 g/mol. Its IUPAC name is 3-[4-[[(4-chlorophenyl)methylamino]methyl]phenyl]-N-[(4-pentylphenyl)methyl]benzamide.
| Compound Name | 3-[4-[[(4-chlorophenyl)methylamino]methyl]phenyl]-N-[(4-pentylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 173155687 |
| Molecular Formula | C33H35ClN2O |
| Molecular Weight | 511.11 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | 3-[4-[[(4-chlorophenyl)methylamino]methyl]phenyl]-N-[(4-pentylphenyl)methyl]benzamide |
| SMILES | CCCCCc1ccc(CNC(=O)c2cccc(-c3ccc(CNCc4ccc(Cl)cc4)cc3)c2)cc1 |
| InChI | InChI=1S/C33H35ClN2O/c1-2-3-4-6-25-9-11-28(12-10-25)24-36-33(37)31-8-5-7-30(21-31)29-17-13-26(14-18-29)22-35-23-27-15-19-32(34)20-16-27/h5,7-21,35H,2-4,6,22-24H2,1H3,(H,36,37) |
| InChIKey | DKOYOUCNYFHGTA-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.11 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|