C33H32Br2FNO — CID 173155725
3,5-dibromo-4-[2-[3-(4-fluorophenyl)phenyl]ethyl]-N-[(4-pentylphenyl)methyl]benzamide (PubChem CID 173155725) has the molecular formula C33H32Br2FNO and a molecular weight of 637.43 g/mol. Its IUPAC name is 3,5-dibromo-4-[2-[3-(4-fluorophenyl)phenyl]ethyl]-N-[(4-pentylphenyl)methyl]benzamide.
| Compound Name | 3,5-dibromo-4-[2-[3-(4-fluorophenyl)phenyl]ethyl]-N-[(4-pentylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 173155725 |
| Molecular Formula | C33H32Br2FNO |
| Molecular Weight | 637.43 g/mol |
| Exact Mass | 635.08 |
| IUPAC Name | 3,5-dibromo-4-[2-[3-(4-fluorophenyl)phenyl]ethyl]-N-[(4-pentylphenyl)methyl]benzamide |
| SMILES | CCCCCc1ccc(CNC(=O)c2cc(Br)c(CCc3cccc(-c4ccc(F)cc4)c3)c(Br)c2)cc1 |
| InChI | InChI=1S/C33H32Br2FNO/c1-2-3-4-6-23-9-11-25(12-10-23)22-37-33(38)28-20-31(34)30(32(35)21-28)18-13-24-7-5-8-27(19-24)26-14-16-29(36)17-15-26/h5,7-12,14-17,19-21H,2-4,6,13,18,22H2,1H3,(H,37,38) |
| InChIKey | JWKQBUHVZMYROP-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.43 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|