C36H37F3N2O3 — CID 154454031
2-[[4-[3-[(4-pentylphenyl)methylcarbamoyl]phenyl]phenyl]methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]acetic acid (PubChem CID 154454031) has the molecular formula C36H37F3N2O3 and a molecular weight of 602.70 g/mol. Its IUPAC name is 2-[[4-[3-[(4-pentylphenyl)methylcarbamoyl]phenyl]phenyl]methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]acetic acid.
| Compound Name | 2-[[4-[3-[(4-pentylphenyl)methylcarbamoyl]phenyl]phenyl]methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]acetic acid |
|---|---|
| PubChem CID | 154454031 |
| Molecular Formula | C36H37F3N2O3 |
| Molecular Weight | 602.70 g/mol |
| Exact Mass | 602.28 |
| IUPAC Name | 2-[[4-[3-[(4-pentylphenyl)methylcarbamoyl]phenyl]phenyl]methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]acetic acid |
| SMILES | CCCCCc1ccc(CNC(=O)c2cccc(-c3ccc(CN(CC(=O)O)Cc4ccc(C(F)(F)F)cc4)cc3)c2)cc1 |
| InChI | InChI=1S/C36H37F3N2O3/c1-2-3-4-6-26-9-11-27(12-10-26)22-40-35(44)32-8-5-7-31(21-32)30-17-13-28(14-18-30)23-41(25-34(42)43)24-29-15-19-33(20-16-29)36(37,38)39/h5,7-21H,2-4,6,22-25H2,1H3,(H,40,44)(H,42,43) |
| InChIKey | NBOUTWOZDTXXQU-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.70 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|