C30H32F3NO3 — CID 67484764
3-[[4-[7-[4-[4-(trifluoromethyl)phenyl]phenyl]heptyl]benzoyl]amino]propanoic acid (PubChem CID 67484764) has the molecular formula C30H32F3NO3 and a molecular weight of 511.58 g/mol. Its IUPAC name is 3-[[4-[7-[4-[4-(trifluoromethyl)phenyl]phenyl]heptyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[7-[4-[4-(trifluoromethyl)phenyl]phenyl]heptyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 67484764 |
| Molecular Formula | C30H32F3NO3 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | 3-[[4-[7-[4-[4-(trifluoromethyl)phenyl]phenyl]heptyl]benzoyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)c1ccc(CCCCCCCc2ccc(-c3ccc(C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H32F3NO3/c31-30(32,33)27-18-16-25(17-19-27)24-12-8-22(9-13-24)6-4-2-1-3-5-7-23-10-14-26(15-11-23)29(37)34-21-20-28(35)36/h8-19H,1-7,20-21H2,(H,34,37)(H,35,36) |
| InChIKey | WDBYIQQPYNNWPF-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|