C29H31F3N2O4 — CID 135263848
3-[[4-[[1-propoxy-3-[4-[4-(trifluoromethyl)phenyl]phenyl]propan-2-yl]amino]benzoyl]amino]propanoic acid (PubChem CID 135263848) has the molecular formula C29H31F3N2O4 and a molecular weight of 528.57 g/mol. Its IUPAC name is 3-[[4-[[1-propoxy-3-[4-[4-(trifluoromethyl)phenyl]phenyl]propan-2-yl]amino]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[[1-propoxy-3-[4-[4-(trifluoromethyl)phenyl]phenyl]propan-2-yl]amino]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 135263848 |
| Molecular Formula | C29H31F3N2O4 |
| Molecular Weight | 528.57 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | 3-[[4-[[1-propoxy-3-[4-[4-(trifluoromethyl)phenyl]phenyl]propan-2-yl]amino]benzoyl]amino]propanoic acid |
| SMILES | CCCOCC(Cc1ccc(-c2ccc(C(F)(F)F)cc2)cc1)Nc1ccc(C(=O)NCCC(=O)O)cc1 |
| InChI | InChI=1S/C29H31F3N2O4/c1-2-17-38-19-26(34-25-13-9-23(10-14-25)28(37)33-16-15-27(35)36)18-20-3-5-21(6-4-20)22-7-11-24(12-8-22)29(30,31)32/h3-14,26,34H,2,15-19H2,1H3,(H,33,37)(H,35,36) |
| InChIKey | VIRBEUQCOKUROM-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.57 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|