C30H36N2O3 — CID 152823886
3-[[4-[[(2S)-1-[4-(4-methylphenyl)phenyl]heptan-2-yl]amino]benzoyl]amino]propanoic acid (PubChem CID 152823886) has the molecular formula C30H36N2O3 and a molecular weight of 472.63 g/mol. Its IUPAC name is 3-[[4-[[(2S)-1-[4-(4-methylphenyl)phenyl]heptan-2-yl]amino]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[[(2S)-1-[4-(4-methylphenyl)phenyl]heptan-2-yl]amino]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 152823886 |
| Molecular Formula | C30H36N2O3 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | 3-[[4-[[(2S)-1-[4-(4-methylphenyl)phenyl]heptan-2-yl]amino]benzoyl]amino]propanoic acid |
| SMILES | CCCCC[C@@H](Cc1ccc(-c2ccc(C)cc2)cc1)Nc1ccc(C(=O)NCCC(=O)O)cc1 |
| InChI | InChI=1S/C30H36N2O3/c1-3-4-5-6-28(21-23-9-13-25(14-10-23)24-11-7-22(2)8-12-24)32-27-17-15-26(16-18-27)30(35)31-20-19-29(33)34/h7-18,28,32H,3-6,19-21H2,1-2H3,(H,31,35)(H,33,34)/t28-/m0/s1 |
| InChIKey | SULCAEHWOOHSDG-NDEPHWFRSA-N |
| XLogP | 6.47 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|