C32H38FNO4 — CID 143156979
3-[[4-[1-[4-[4-(2-fluoropropan-2-yl)phenyl]phenoxy]heptyl]benzoyl]amino]propanoic acid (PubChem CID 143156979) has the molecular formula C32H38FNO4 and a molecular weight of 519.66 g/mol. Its IUPAC name is 3-[[4-[1-[4-[4-(2-fluoropropan-2-yl)phenyl]phenoxy]heptyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[1-[4-[4-(2-fluoropropan-2-yl)phenyl]phenoxy]heptyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 143156979 |
| Molecular Formula | C32H38FNO4 |
| Molecular Weight | 519.66 g/mol |
| Exact Mass | 519.28 |
| IUPAC Name | 3-[[4-[1-[4-[4-(2-fluoropropan-2-yl)phenyl]phenoxy]heptyl]benzoyl]amino]propanoic acid |
| SMILES | CCCCCCC(Oc1ccc(-c2ccc(C(C)(C)F)cc2)cc1)c1ccc(C(=O)NCCC(=O)O)cc1 |
| InChI | InChI=1S/C32H38FNO4/c1-4-5-6-7-8-29(25-9-11-26(12-10-25)31(37)34-22-21-30(35)36)38-28-19-15-24(16-20-28)23-13-17-27(18-14-23)32(2,3)33/h9-20,29H,4-8,21-22H2,1-3H3,(H,34,37)(H,35,36) |
| InChIKey | MPUUOIABZUEYIZ-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.66 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|