C28H39NO5 — CID 59518046
3-[[4-[1-(4-pentoxyphenoxy)heptyl]benzoyl]amino]propanoic acid (PubChem CID 59518046) has the molecular formula C28H39NO5 and a molecular weight of 469.62 g/mol. Its IUPAC name is 3-[[4-[1-(4-pentoxyphenoxy)heptyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[1-(4-pentoxyphenoxy)heptyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 59518046 |
| Molecular Formula | C28H39NO5 |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | 3-[[4-[1-(4-pentoxyphenoxy)heptyl]benzoyl]amino]propanoic acid |
| SMILES | CCCCCCC(Oc1ccc(OCCCCC)cc1)c1ccc(C(=O)NCCC(=O)O)cc1 |
| InChI | InChI=1S/C28H39NO5/c1-3-5-7-8-10-26(34-25-17-15-24(16-18-25)33-21-9-6-4-2)22-11-13-23(14-12-22)28(32)29-20-19-27(30)31/h11-18,26H,3-10,19-21H2,1-2H3,(H,29,32)(H,30,31) |
| InChIKey | LYMSWYYRHDBEDT-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|