C23H29NO5 — CID 59518137
3-[[4-[1-(4-hydroxyphenoxy)heptyl]benzoyl]amino]propanoic acid (PubChem CID 59518137) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is 3-[[4-[1-(4-hydroxyphenoxy)heptyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[1-(4-hydroxyphenoxy)heptyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 59518137 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 3-[[4-[1-(4-hydroxyphenoxy)heptyl]benzoyl]amino]propanoic acid |
| SMILES | CCCCCCC(Oc1ccc(O)cc1)c1ccc(C(=O)NCCC(=O)O)cc1 |
| InChI | InChI=1S/C23H29NO5/c1-2-3-4-5-6-21(29-20-13-11-19(25)12-14-20)17-7-9-18(10-8-17)23(28)24-16-15-22(26)27/h7-14,21,25H,2-6,15-16H2,1H3,(H,24,28)(H,26,27) |
| InChIKey | MGVLXIBGTVHBLI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|