C30H32F3NO4 — CID 67153601
methyl 3-[[4-[1-[4-[4-(trifluoromethyl)phenyl]phenoxy]hexyl]benzoyl]amino]propanoate (PubChem CID 67153601) has the molecular formula C30H32F3NO4 and a molecular weight of 527.58 g/mol. Its IUPAC name is methyl 3-[[4-[1-[4-[4-(trifluoromethyl)phenyl]phenoxy]hexyl]benzoyl]amino]propanoate.
| Compound Name | methyl 3-[[4-[1-[4-[4-(trifluoromethyl)phenyl]phenoxy]hexyl]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 67153601 |
| Molecular Formula | C30H32F3NO4 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | methyl 3-[[4-[1-[4-[4-(trifluoromethyl)phenyl]phenoxy]hexyl]benzoyl]amino]propanoate |
| SMILES | CCCCCC(Oc1ccc(-c2ccc(C(F)(F)F)cc2)cc1)c1ccc(C(=O)NCCC(=O)OC)cc1 |
| InChI | InChI=1S/C30H32F3NO4/c1-3-4-5-6-27(23-7-9-24(10-8-23)29(36)34-20-19-28(35)37-2)38-26-17-13-22(14-18-26)21-11-15-25(16-12-21)30(31,32)33/h7-18,27H,3-6,19-20H2,1-2H3,(H,34,36) |
| InChIKey | ZNTSYRBNCVQZLM-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|