C26H26F3NO2 — CID 141128251
4-[1-[4-[4-(trifluoromethyl)phenyl]phenoxy]hexyl]benzamide (PubChem CID 141128251) has the molecular formula C26H26F3NO2 and a molecular weight of 441.49 g/mol. Its IUPAC name is 4-[1-[4-[4-(trifluoromethyl)phenyl]phenoxy]hexyl]benzamide.
| Compound Name | 4-[1-[4-[4-(trifluoromethyl)phenyl]phenoxy]hexyl]benzamide |
|---|---|
| PubChem CID | 141128251 |
| Molecular Formula | C26H26F3NO2 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 4-[1-[4-[4-(trifluoromethyl)phenyl]phenoxy]hexyl]benzamide |
| SMILES | CCCCCC(Oc1ccc(-c2ccc(C(F)(F)F)cc2)cc1)c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C26H26F3NO2/c1-2-3-4-5-24(20-6-8-21(9-7-20)25(30)31)32-23-16-12-19(13-17-23)18-10-14-22(15-11-18)26(27,28)29/h6-17,24H,2-5H2,1H3,(H2,30,31) |
| InChIKey | LHJMRIQRLAGKKG-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|