C27H28F3NO2 — CID 141128231
4-[5-methyl-1-[4-[4-(trifluoromethyl)phenyl]phenoxy]hexyl]benzamide (PubChem CID 141128231) has the molecular formula C27H28F3NO2 and a molecular weight of 455.52 g/mol. Its IUPAC name is 4-[5-methyl-1-[4-[4-(trifluoromethyl)phenyl]phenoxy]hexyl]benzamide.
| Compound Name | 4-[5-methyl-1-[4-[4-(trifluoromethyl)phenyl]phenoxy]hexyl]benzamide |
|---|---|
| PubChem CID | 141128231 |
| Molecular Formula | C27H28F3NO2 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 4-[5-methyl-1-[4-[4-(trifluoromethyl)phenyl]phenoxy]hexyl]benzamide |
| SMILES | CC(C)CCCC(Oc1ccc(-c2ccc(C(F)(F)F)cc2)cc1)c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C27H28F3NO2/c1-18(2)4-3-5-25(21-6-8-22(9-7-21)26(31)32)33-24-16-12-20(13-17-24)19-10-14-23(15-11-19)27(28,29)30/h6-18,25H,3-5H2,1-2H3,(H2,31,32) |
| InChIKey | AUYUHELAGAOBOP-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |