C26H26F3NO3 — CID 67375362
4-[(1S)-1-[6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]heptoxy]benzoic acid (PubChem CID 67375362) has the molecular formula C26H26F3NO3 and a molecular weight of 457.49 g/mol. Its IUPAC name is 4-[(1S)-1-[6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]heptoxy]benzoic acid.
| Compound Name | 4-[(1S)-1-[6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]heptoxy]benzoic acid |
|---|---|
| PubChem CID | 67375362 |
| Molecular Formula | C26H26F3NO3 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 4-[(1S)-1-[6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]heptoxy]benzoic acid |
| SMILES | CCCCCC[C@H](Oc1ccc(C(=O)O)cc1)c1ccc(-c2ccc(C(F)(F)F)cc2)nc1 |
| InChI | InChI=1S/C26H26F3NO3/c1-2-3-4-5-6-24(33-22-14-9-19(10-15-22)25(31)32)20-11-16-23(30-17-20)18-7-12-21(13-8-18)26(27,28)29/h7-17,24H,2-6H2,1H3,(H,31,32)/t24-/m0/s1 |
| InChIKey | PCPDTPIQPXZKFC-DEOSSOPVSA-N |
| XLogP | 7.56 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|