C26H25F4NO3 — CID 67344002
3-fluoro-4-[1-[6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]heptoxy]benzoic acid (PubChem CID 67344002) has the molecular formula C26H25F4NO3 and a molecular weight of 475.48 g/mol. Its IUPAC name is 3-fluoro-4-[1-[6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]heptoxy]benzoic acid.
| Compound Name | 3-fluoro-4-[1-[6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]heptoxy]benzoic acid |
|---|---|
| PubChem CID | 67344002 |
| Molecular Formula | C26H25F4NO3 |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 3-fluoro-4-[1-[6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]heptoxy]benzoic acid |
| SMILES | CCCCCCC(Oc1ccc(C(=O)O)cc1F)c1ccc(-c2ccc(C(F)(F)F)cc2)nc1 |
| InChI | InChI=1S/C26H25F4NO3/c1-2-3-4-5-6-23(34-24-14-10-18(25(32)33)15-21(24)27)19-9-13-22(31-16-19)17-7-11-20(12-8-17)26(28,29)30/h7-16,23H,2-6H2,1H3,(H,32,33) |
| InChIKey | XXDVVQRNJZEMCR-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|