C31H33F3O4 — CID 58279747
5-oxo-5-[4-[1-[4-[4-(trifluoromethyl)phenyl]phenoxy]heptyl]phenyl]pentanoic acid (PubChem CID 58279747) has the molecular formula C31H33F3O4 and a molecular weight of 526.60 g/mol. Its IUPAC name is 5-oxo-5-[4-[1-[4-[4-(trifluoromethyl)phenyl]phenoxy]heptyl]phenyl]pentanoic acid.
| Compound Name | 5-oxo-5-[4-[1-[4-[4-(trifluoromethyl)phenyl]phenoxy]heptyl]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 58279747 |
| Molecular Formula | C31H33F3O4 |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | 5-oxo-5-[4-[1-[4-[4-(trifluoromethyl)phenyl]phenoxy]heptyl]phenyl]pentanoic acid |
| SMILES | CCCCCCC(Oc1ccc(-c2ccc(C(F)(F)F)cc2)cc1)c1ccc(C(=O)CCCC(=O)O)cc1 |
| InChI | InChI=1S/C31H33F3O4/c1-2-3-4-5-8-29(25-12-10-24(11-13-25)28(35)7-6-9-30(36)37)38-27-20-16-23(17-21-27)22-14-18-26(19-15-22)31(32,33)34/h10-21,29H,2-9H2,1H3,(H,36,37) |
| InChIKey | KWRGKMDXIZARAE-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|