About 3-fluoro-4-octoxybenzoic acid;hydrochloride
3-fluoro-4-octoxybenzoic acid;hydrochloride (PubChem CID 70117838) has the molecular formula C15H22ClFO3
and a molecular weight of 304.79 g/mol. Its IUPAC name is 3-fluoro-4-octoxybenzoic acid;hydrochloride.
Molecular Properties
| Compound Name | 3-fluoro-4-octoxybenzoic acid;hydrochloride |
| PubChem CID | 70117838 |
| Molecular Formula | C15H22ClFO3 |
| Molecular Weight | 304.79 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 3-fluoro-4-octoxybenzoic acid;hydrochloride |
| SMILES | CCCCCCCCOc1ccc(C(=O)O)cc1F.Cl |
| InChI | InChI=1S/C15H21FO3.ClH/c1-2-3-4-5-6-7-10-19-14-9-8-12(15(17)18)11-13(14)16;/h8-9,11H,2-7,10H2,1H3,(H,17,18);1H |
| InChIKey | BOQVGFGOGIKLIJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.79 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-4-octoxybenzoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4-octoxybenzoic acid;hydrochloride?
The IUPAC name of 3-fluoro-4-octoxybenzoic acid;hydrochloride (CID 70117838) is 3-fluoro-4-octoxybenzoic acid;hydrochloride.
What is the SMILES notation for 3-fluoro-4-octoxybenzoic acid;hydrochloride?
The canonical SMILES for 3-fluoro-4-octoxybenzoic acid;hydrochloride is CCCCCCCCOc1ccc(C(=O)O)cc1F.Cl.
What is the InChIKey of 3-fluoro-4-octoxybenzoic acid;hydrochloride?
The InChIKey is BOQVGFGOGIKLIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21FO3.ClH/c1-2-3-4-5-6-7-10-19-14-9-8-12(15(17)18)11-13(14)16;/h8-9,11H,2-7,10H2,1H3,(H,17,18);1H.
What are the key properties of 3-fluoro-4-octoxybenzoic acid;hydrochloride?
3-fluoro-4-octoxybenzoic acid;hydrochloride has a molecular weight of 304.79 g/mol, XLogP of 4.68, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-octoxybenzoic acid;hydrochloride is sourced from PubChem (CID 70117838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).