C17H25FO3U — CID 163711156
carbanide;ethyl 3-fluoro-4-heptoxybenzoate;uranium(2+) (PubChem CID 163711156) has the molecular formula C17H25FO3U and a molecular weight of 534.41 g/mol. Its IUPAC name is carbanide;ethyl 3-fluoro-4-heptoxybenzoate;uranium(2+).
| Compound Name | carbanide;ethyl 3-fluoro-4-heptoxybenzoate;uranium(2+) |
|---|---|
| PubChem CID | 163711156 |
| Molecular Formula | C17H25FO3U |
| Molecular Weight | 534.41 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | carbanide;ethyl 3-fluoro-4-heptoxybenzoate;uranium(2+) |
| SMILES | [CH2-]COC(=O)c1ccc(OCCCCCCC)c(F)c1.[CH3-].[U+2] |
| InChI | InChI=1S/C16H22FO3.CH3.U/c1-3-5-6-7-8-11-20-15-10-9-13(12-14(15)17)16(18)19-4-2;;/h9-10,12H,2-8,11H2,1H3;1H3;/q2*-1;+2 |
| InChIKey | BNCLUYJKUMQYQG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|