About 4-hexoxy-3-iodobenzoic acid
4-hexoxy-3-iodobenzoic acid (PubChem CID 44828901) has the molecular formula C13H17IO3
and a molecular weight of 348.18 g/mol. Its IUPAC name is 4-hexoxy-3-iodobenzoic acid.
Molecular Properties
| Compound Name | 4-hexoxy-3-iodobenzoic acid |
| PubChem CID | 44828901 |
| Molecular Formula | C13H17IO3 |
| Molecular Weight | 348.18 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 4-hexoxy-3-iodobenzoic acid |
| SMILES | CCCCCCOc1ccc(C(=O)O)cc1I |
| InChI | InChI=1S/C13H17IO3/c1-2-3-4-5-8-17-12-7-6-10(13(15)16)9-11(12)14/h6-7,9H,2-5,8H2,1H3,(H,15,16) |
| InChIKey | LHVYCDHEIWPZAI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.18 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-hexoxy-3-iodobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hexoxy-3-iodobenzoic acid?
The IUPAC name of 4-hexoxy-3-iodobenzoic acid (CID 44828901) is 4-hexoxy-3-iodobenzoic acid.
What is the SMILES notation for 4-hexoxy-3-iodobenzoic acid?
The canonical SMILES for 4-hexoxy-3-iodobenzoic acid is CCCCCCOc1ccc(C(=O)O)cc1I.
What is the InChIKey of 4-hexoxy-3-iodobenzoic acid?
The InChIKey is LHVYCDHEIWPZAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17IO3/c1-2-3-4-5-8-17-12-7-6-10(13(15)16)9-11(12)14/h6-7,9H,2-5,8H2,1H3,(H,15,16).
What are the key properties of 4-hexoxy-3-iodobenzoic acid?
4-hexoxy-3-iodobenzoic acid has a molecular weight of 348.18 g/mol, XLogP of 3.95, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hexoxy-3-iodobenzoic acid is sourced from PubChem (CID 44828901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).