C25H25F3N2O — CID 141172180
4-[3-methyl-1-[4-[4-(trifluoromethyl)phenyl]anilino]butyl]benzamide (PubChem CID 141172180) has the molecular formula C25H25F3N2O and a molecular weight of 426.48 g/mol. Its IUPAC name is 4-[3-methyl-1-[4-[4-(trifluoromethyl)phenyl]anilino]butyl]benzamide.
| Compound Name | 4-[3-methyl-1-[4-[4-(trifluoromethyl)phenyl]anilino]butyl]benzamide |
|---|---|
| PubChem CID | 141172180 |
| Molecular Formula | C25H25F3N2O |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 4-[3-methyl-1-[4-[4-(trifluoromethyl)phenyl]anilino]butyl]benzamide |
| SMILES | CC(C)CC(Nc1ccc(-c2ccc(C(F)(F)F)cc2)cc1)c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C25H25F3N2O/c1-16(2)15-23(19-3-5-20(6-4-19)24(29)31)30-22-13-9-18(10-14-22)17-7-11-21(12-8-17)25(26,27)28/h3-14,16,23,30H,15H2,1-2H3,(H2,29,31) |
| InChIKey | FBRYEYRHYGEZTB-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |