C18H19F3O — CID 67342546
(1S)-3-methyl-1-[4-[4-(trifluoromethyl)phenyl]phenyl]butan-1-ol (PubChem CID 67342546) has the molecular formula C18H19F3O and a molecular weight of 308.34 g/mol. Its IUPAC name is (1S)-3-methyl-1-[4-[4-(trifluoromethyl)phenyl]phenyl]butan-1-ol.
| Compound Name | (1S)-3-methyl-1-[4-[4-(trifluoromethyl)phenyl]phenyl]butan-1-ol |
|---|---|
| PubChem CID | 67342546 |
| Molecular Formula | C18H19F3O |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (1S)-3-methyl-1-[4-[4-(trifluoromethyl)phenyl]phenyl]butan-1-ol |
| SMILES | CC(C)C[C@H](O)c1ccc(-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H19F3O/c1-12(2)11-17(22)15-5-3-13(4-6-15)14-7-9-16(10-8-14)18(19,20)21/h3-10,12,17,22H,11H2,1-2H3/t17-/m0/s1 |
| InChIKey | YWMUJBKURLQZGH-KRWDZBQOSA-N |
| XLogP | 5.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |