C13H15F3O — CID 132560145
(1S,3R)-3-methyl-1-[4-(trifluoromethyl)phenyl]pent-4-en-1-ol (PubChem CID 132560145) has the molecular formula C13H15F3O and a molecular weight of 244.26 g/mol. Its IUPAC name is (1S,3R)-3-methyl-1-[4-(trifluoromethyl)phenyl]pent-4-en-1-ol.
| Compound Name | (1S,3R)-3-methyl-1-[4-(trifluoromethyl)phenyl]pent-4-en-1-ol |
|---|---|
| PubChem CID | 132560145 |
| Molecular Formula | C13H15F3O |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (1S,3R)-3-methyl-1-[4-(trifluoromethyl)phenyl]pent-4-en-1-ol |
| SMILES | C=C[C@H](C)C[C@H](O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H15F3O/c1-3-9(2)8-12(17)10-4-6-11(7-5-10)13(14,15)16/h3-7,9,12,17H,1,8H2,2H3/t9-,12-/m0/s1 |
| InChIKey | JVLCOLJDBUMSJC-CABZTGNLSA-N |
| XLogP | 3.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|