C10H11F3O4S — CID 87402636
[(2S)-2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl] methanesulfonate (PubChem CID 87402636) has the molecular formula C10H11F3O4S and a molecular weight of 284.26 g/mol. Its IUPAC name is [(2S)-2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl] methanesulfonate.
| Compound Name | [(2S)-2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl] methanesulfonate |
|---|---|
| PubChem CID | 87402636 |
| Molecular Formula | C10H11F3O4S |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | [(2S)-2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl] methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@@H](O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H11F3O4S/c1-18(15,16)17-6-9(14)7-2-4-8(5-3-7)10(11,12)13/h2-5,9,14H,6H2,1H3/t9-/m1/s1 |
| InChIKey | DILLNTYVXWBWMS-SECBINFHSA-N |
| XLogP | 1.72 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|