C20H20F6O6S2 — CID 122394942
[(1R,4R)-4-methylsulfonyloxy-1,4-bis[4-(trifluoromethyl)phenyl]butyl] methanesulfonate (PubChem CID 122394942) has the molecular formula C20H20F6O6S2 and a molecular weight of 534.50 g/mol. Its IUPAC name is [(1R,4R)-4-methylsulfonyloxy-1,4-bis[4-(trifluoromethyl)phenyl]butyl] methanesulfonate.
| Compound Name | [(1R,4R)-4-methylsulfonyloxy-1,4-bis[4-(trifluoromethyl)phenyl]butyl] methanesulfonate |
|---|---|
| PubChem CID | 122394942 |
| Molecular Formula | C20H20F6O6S2 |
| Molecular Weight | 534.50 g/mol |
| Exact Mass | 534.06 |
| IUPAC Name | [(1R,4R)-4-methylsulfonyloxy-1,4-bis[4-(trifluoromethyl)phenyl]butyl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@H](CC[C@@H](OS(C)(=O)=O)c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H20F6O6S2/c1-33(27,28)31-17(13-3-7-15(8-4-13)19(21,22)23)11-12-18(32-34(2,29)30)14-5-9-16(10-6-14)20(24,25)26/h3-10,17-18H,11-12H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | RXYBDIHSWWUANR-QZTJIDSGSA-N |
| XLogP | 5.24 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|