C12H15F3O2S2 — CID 95315641
1-[(1S)-1-(2-methylsulfonylethylsulfanyl)ethyl]-4-(trifluoromethyl)benzene (PubChem CID 95315641) has the molecular formula C12H15F3O2S2 and a molecular weight of 312.38 g/mol. Its IUPAC name is 1-[(1S)-1-(2-methylsulfonylethylsulfanyl)ethyl]-4-(trifluoromethyl)benzene.
| Compound Name | 1-[(1S)-1-(2-methylsulfonylethylsulfanyl)ethyl]-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 95315641 |
| Molecular Formula | C12H15F3O2S2 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 1-[(1S)-1-(2-methylsulfonylethylsulfanyl)ethyl]-4-(trifluoromethyl)benzene |
| SMILES | C[C@H](SCCS(C)(=O)=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H15F3O2S2/c1-9(18-7-8-19(2,16)17)10-3-5-11(6-4-10)12(13,14)15/h3-6,9H,7-8H2,1-2H3/t9-/m0/s1 |
| InChIKey | WJMGUWSBTVPVBW-VIFPVBQESA-N |
| XLogP | 3.54 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |