methyl 4-(3-methylsulfonyl-1-methylsulfonyloxypropyl)benzoate

C13H18O7S2 — CID 141461802

IUPACmethyl 4-(3-methylsulfonyl-1-methylsulfonyloxypropyl)benzoate
SMILESCOC(=O)c1ccc(C(CCS(C)(=O)=O)OS(C)(=O)=O)cc1
InChIInChI=1S/C13H18O7S2/c1-19-13(14)11-6-4-10(5-7-11)12(20-22(3,17)18)8-9-21(2,15)16/h4-7,12H,8-9H2,1-3H3
InChIKeyLSBXCXZLBIBTEL-UHFFFAOYSA-N
MW350.41 g/mol
LogP0.93
Rot. Bonds7

About methyl 4-(3-methylsulfonyl-1-methylsulfonyloxypropyl)benzoate

methyl 4-(3-methylsulfonyl-1-methylsulfonyloxypropyl)benzoate (PubChem CID 141461802) has the molecular formula C13H18O7S2 and a molecular weight of 350.41 g/mol. Its IUPAC name is methyl 4-(3-methylsulfonyl-1-methylsulfonyloxypropyl)benzoate.

Molecular Properties

Compound Namemethyl 4-(3-methylsulfonyl-1-methylsulfonyloxypropyl)benzoate
PubChem CID141461802
Molecular FormulaC13H18O7S2
Molecular Weight350.41 g/mol
Exact Mass350.05
IUPAC Namemethyl 4-(3-methylsulfonyl-1-methylsulfonyloxypropyl)benzoate
SMILESCOC(=O)c1ccc(C(CCS(C)(=O)=O)OS(C)(=O)=O)cc1
InChIInChI=1S/C13H18O7S2/c1-19-13(14)11-6-4-10(5-7-11)12(20-22(3,17)18)8-9-21(2,15)16/h4-7,12H,8-9H2,1-3H3
InChIKeyLSBXCXZLBIBTEL-UHFFFAOYSA-N
XLogP0.93
TPSA103.81 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds7
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500350.41
LogP ≤ 50.93
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}

Analyze methyl 4-(3-methylsulfonyl-1-methylsulfonyloxypropyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(3-methylsulfonyl-1-methylsulfonyloxypropyl)benzoate?
The IUPAC name of methyl 4-(3-methylsulfonyl-1-methylsulfonyloxypropyl)benzoate (CID 141461802) is methyl 4-(3-methylsulfonyl-1-methylsulfonyloxypropyl)benzoate.
What is the SMILES notation for methyl 4-(3-methylsulfonyl-1-methylsulfonyloxypropyl)benzoate?
The canonical SMILES for methyl 4-(3-methylsulfonyl-1-methylsulfonyloxypropyl)benzoate is COC(=O)c1ccc(C(CCS(C)(=O)=O)OS(C)(=O)=O)cc1.
What is the InChIKey of methyl 4-(3-methylsulfonyl-1-methylsulfonyloxypropyl)benzoate?
The InChIKey is LSBXCXZLBIBTEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O7S2/c1-19-13(14)11-6-4-10(5-7-11)12(20-22(3,17)18)8-9-21(2,15)16/h4-7,12H,8-9H2,1-3H3.
What are the key properties of methyl 4-(3-methylsulfonyl-1-methylsulfonyloxypropyl)benzoate?
methyl 4-(3-methylsulfonyl-1-methylsulfonyloxypropyl)benzoate has a molecular weight of 350.41 g/mol, XLogP of 0.93, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(3-methylsulfonyl-1-methylsulfonyloxypropyl)benzoate is sourced from PubChem (CID 141461802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).