C10H11F3O4S — CID 59113926
[(1R)-2-methoxy-1-[4-(trifluoromethyl)phenyl]ethyl] hydrogen sulfite (PubChem CID 59113926) has the molecular formula C10H11F3O4S and a molecular weight of 284.26 g/mol. Its IUPAC name is [(1R)-2-methoxy-1-[4-(trifluoromethyl)phenyl]ethyl] hydrogen sulfite.
| Compound Name | [(1R)-2-methoxy-1-[4-(trifluoromethyl)phenyl]ethyl] hydrogen sulfite |
|---|---|
| PubChem CID | 59113926 |
| Molecular Formula | C10H11F3O4S |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | [(1R)-2-methoxy-1-[4-(trifluoromethyl)phenyl]ethyl] hydrogen sulfite |
| SMILES | COC[C@H](OS(=O)O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H11F3O4S/c1-16-6-9(17-18(14)15)7-2-4-8(5-3-7)10(11,12)13/h2-5,9H,6H2,1H3,(H,14,15)/t9-/m0/s1 |
| InChIKey | OCNBBUPVYRGDAI-VIFPVBQESA-N |
| XLogP | 2.55 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|